EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30780 - maleate(2−)
| Formula | C4H2O4 |
| Net Charge | -2 |
| Average Mass | 114.056 |
| Monoisotopic Mass | 113.99641 |
| SMILES | O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1- |
| InChIKey | VZCYOOQTPOCHFL-UPHRSURJSA-L |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maleate(2−) (CHEBI:30780) has role plant metabolite (CHEBI:76924) |
| maleate(2−) (CHEBI:30780) is a butenedioate (CHEBI:36180) |
| maleate(2−) (CHEBI:30780) is a C4-dicarboxylate (CHEBI:61336) |
| maleate(2−) (CHEBI:30780) is a maleate (CHEBI:132951) |
| maleate(2−) (CHEBI:30780) is conjugate base of maleate(1−) (CHEBI:37156) |
| Incoming Relation(s) |
| dimethylmaleate(2−) (CHEBI:17081) has functional parent maleate(2−) (CHEBI:30780) |
| disodium maleate (CHEBI:91263) has part maleate(2−) (CHEBI:30780) |
| domperidone maleate (CHEBI:59812) has part maleate(2−) (CHEBI:30780) |
| trimipramine maleate (CHEBI:35030) has part maleate(2−) (CHEBI:30780) |
| maleate(1−) (CHEBI:37156) is conjugate acid of maleate(2−) (CHEBI:30780) |
| IUPAC Name |
|---|
| (2Z)-but-2-enedioate |
| Synonym | Source |
|---|---|
| male | IUPAC |
| UniProt Name | Source |
|---|---|
| maleate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:49853 | Gmelin |
| Reaxys:3588415 | Reaxys |