EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2.C4H2O4 |
| Net Charge | 0 |
| Average Mass | 410.514 |
| Monoisotopic Mass | 410.22056 |
| SMILES | O=C([O-])/C=C\C(=O)[O-].[H][N+](C)(C)CC(C)C[N+]1([H])c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H26N2.C4H4O4/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22;5-3(6)1-2-4(7)8/h4-11,16H,12-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YDGHCKHAXOUQOS-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimipramine maleate (CHEBI:35030) has part maleate(2−) (CHEBI:30780) |
| trimipramine maleate (CHEBI:35030) has part trimipramine (CHEBI:9738) |
| trimipramine maleate (CHEBI:35030) has role antidepressant (CHEBI:35469) |
| trimipramine maleate (CHEBI:35030) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 5-[3-(dimethylammonio)-2-methylpropyl]-10,11-dihydro-5H-dibenzo[b,f]azepinium (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 10,11-dihydro-N,N,β-trimethyl-5H-dibenz(b,f)azepine-5-propanamine (Z)-2-butenedioate (1:1) | ChemIDplus |
| 5-(3-(dimethylamino)-2-methylpropyl)-10,11-dihydro-5H-dibenz(b,f)azepine maleate (1:1) | ChemIDplus |
| Trimipramine maleate | KEGG COMPOUND |