EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | -2 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02771 |
| SMILES | C/C(C(=O)[O-])=C(\C)C(=O)[O-] |
| InChI | InChI=1S/C6H8O4/c1-3(5(7)8)4(2)6(9)10/h1-2H3,(H,7,8)(H,9,10)/p-2/b4-3- |
| InChIKey | CGBYBGVMDAPUIH-ARJAWSKDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylmaleate(2−) (CHEBI:17081) has functional parent maleate(2−) (CHEBI:30780) |
| dimethylmaleate(2−) (CHEBI:17081) is a dicarboxylic acid dianion (CHEBI:28965) |
| dimethylmaleate(2−) (CHEBI:17081) is conjugate base of dimethylmaleic acid (CHEBI:23812) |
| Incoming Relation(s) |
| dimethylmaleic acid (CHEBI:23812) is conjugate acid of dimethylmaleate(2−) (CHEBI:17081) |
| IUPAC Name |
|---|
| (2Z)-2,3-dimethylbut-2-enedioate |
| Synonyms | Source |
|---|---|
| 2,3-dimethylmaleate | ChEBI |
| Dimethylmaleate | KEGG COMPOUND |
| dimethylmaleic acid dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| dimethylmaleate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00922 | KEGG COMPOUND |
| C00922 | KEGG COMPOUND |
| C00922 | KEGG COMPOUND |
| DIMETHYLMAL-CPD | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3664409 | Beilstein |
| Citations |
|---|