EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2O4 |
| Net Charge | -2 |
| Average Mass | 114.056 |
| Monoisotopic Mass | 113.99641 |
| SMILES | [H]C(C(=O)[O-])=C([H])C(=O)[O-] |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2 |
| InChIKey | VZCYOOQTPOCHFL-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butenedioate (CHEBI:36180) is a C4-dicarboxylate (CHEBI:61336) |
| butenedioate (CHEBI:36180) is a dicarboxylic acid dianion (CHEBI:28965) |
| butenedioate (CHEBI:36180) is conjugate base of hydrogen butenedioate (CHEBI:37155) |
| Incoming Relation(s) |
| enol-oxaloacetate (CHEBI:17479) has functional parent butenedioate (CHEBI:36180) |
| citramalate(2−) (CHEBI:13997) has functional parent butenedioate (CHEBI:36180) |
| fumarate(2−) (CHEBI:29806) is a butenedioate (CHEBI:36180) |
| maleate(2−) (CHEBI:30780) is a butenedioate (CHEBI:36180) |
| hydrogen butenedioate (CHEBI:37155) is conjugate acid of butenedioate (CHEBI:36180) |
| IUPAC Name |
|---|
| but-2-enedioate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:874013 | Gmelin |