EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26ClN5O2.C4H2O4 |
| Net Charge | 0 |
| Average Mass | 541.992 |
| Monoisotopic Mass | 541.17281 |
| SMILES | O=C([O-])/C=C\C(=O)[O-].O=C1[NH2+]c2ccccc2N1CCCN1CCC(N2C(=O)[NH2+]c3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C22H24ClN5O2.C4H4O4/c23-15-6-7-20-18(14-15)25-22(30)28(20)16-8-12-26(13-9-16)10-3-11-27-19-5-2-1-4-17(19)24-21(27)29;5-3(6)1-2-4(7)8/h1-2,4-7,14,16H,3,8-13H2,(H,24,29)(H,25,30);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OAUUYDZHCOULIO-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| domperidone maleate (CHEBI:59812) has part domperidone (CHEBI:31515) |
| domperidone maleate (CHEBI:59812) has part maleate(2−) (CHEBI:30780) |
| domperidone maleate (CHEBI:59812) has role antiemetic (CHEBI:50919) |
| domperidone maleate (CHEBI:59812) has role dopaminergic antagonist (CHEBI:48561) |
| domperidone maleate (CHEBI:59812) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 6-chloro-2-oxo-3-{1-[3-(2-oxo-2,3-dihydro-1H-3,1-benzimidazol-3-ium-1-yl)propyl]piperidin-4-yl}-2,3-dihydro-1H-benzimidazol-1-ium (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 5-chloro-1-(1-(3-(2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)propyl)piperidin-4-yl)-1,3-dihydro-2H-benzimidazol-2-one maleate | ChemIDplus |
| 5-chloro-1-{1-[3-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)propyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one (2Z)-but-2-enedioate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| D07868 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:83898-65-1 | ChemIDplus |
| CAS:99497-03-7 | KEGG DRUG |