EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O |
| Net Charge | 0 |
| Average Mass | 384.648 |
| Monoisotopic Mass | 384.33922 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 |
| InChIKey | QYSXJUFSXHHAJI-YRZJJWOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calciol (CHEBI:28940) has role geroprotector (CHEBI:176497) |
| calciol (CHEBI:28940) has role human metabolite (CHEBI:77746) |
| calciol (CHEBI:28940) is a D3 vitamins (CHEBI:73558) |
| calciol (CHEBI:28940) is a hydroxy seco-steroid (CHEBI:36853) |
| calciol (CHEBI:28940) is a seco-cholestane (CHEBI:36818) |
| calciol (CHEBI:28940) is a secondary alcohol (CHEBI:35681) |
| calciol (CHEBI:28940) is a steroid hormone (CHEBI:26764) |
| Incoming Relation(s) |
| (24R)-1α,24-dihydroxy-22-oxavitamin D3 (CHEBI:73923) has functional parent calciol (CHEBI:28940) |
| 1α,23(S),25-trihydroxyvitamin D3 (CHEBI:90970) has functional parent calciol (CHEBI:28940) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) has functional parent calciol (CHEBI:28940) |
| 5,6-trans-vitamin D3 (CHEBI:145213) has functional parent calciol (CHEBI:28940) |
| alfacalcidol (CHEBI:31186) has functional parent calciol (CHEBI:28940) |
| hydroxycalciol (CHEBI:47042) has functional parent calciol (CHEBI:28940) |
| oxocalciol (CHEBI:47806) has functional parent calciol (CHEBI:28940) |
| tacalcitol (CHEBI:32176) has functional parent calciol (CHEBI:28940) |
| IUPAC Name |
|---|
| (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol |
| Synonyms | Source |
|---|---|
| (1S,3Z)-3-[(2E)-2-[(1R,3AR,7AS)-7A-METHYL-1-[(2R)-6-METHYLHEPTAN-2-YL]-2,3,3A,5,6,7-HEXAHYDRO-1H-INDEN-4-YLIDENE]ETHYLIDENE]-4-METHYLIDENE-CYCLOHEXAN-1-OL | PDBeChem |
| (3β,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol | NIST Chemistry WebBook |
| (5Z,7E)-(3S)-9,10-secocholesta-5,7,10(19)-trien-3-ol | JCBN |
| activated 7-dehydrocholesterol | ChemIDplus |
| calciol | JCBN |
| CC | ChemIDplus |
| Brand Name | Source |
|---|---|
| Delta-D | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| calciol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 160 | PPDB |
| 2840 | DrugCentral |
| C05443 | KEGG COMPOUND |
| C05443 | KEGG COMPOUND |
| Cholecalciferol | Wikipedia |
| D00188 | KEGG DRUG |
| DB00169 | DrugBank |
| HMDB0000876 | HMDB |
| LMST03020000 | LIPID MAPS |
| LMST03020001 | LIPID MAPS |
| VD3 | PDBeChem |
| Citations |
|---|