EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 |
| InChIKey | OFHCOWSQAMBJIW-AVJTYSNKSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alfacalcidol (CHEBI:31186) has functional parent calciol (CHEBI:28940) |
| alfacalcidol (CHEBI:31186) has role bone density conservation agent (CHEBI:50646) |
| alfacalcidol (CHEBI:31186) is a D3 vitamins (CHEBI:73558) |
| alfacalcidol (CHEBI:31186) is a diol (CHEBI:23824) |
| alfacalcidol (CHEBI:31186) is a hydroxycalciol (CHEBI:47042) |
| alfacalcidol (CHEBI:31186) is a seco-cholestane (CHEBI:36818) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E)-9,10-secocholesta-5,7,10-triene-1,3-diol |
| INNs | Source |
|---|---|
| alfacalcidol | WHO MedNet |
| alfacalcidol | WHO MedNet |
| alfacalcidol | WHO MedNet |
| alfacalcidolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1α-hydroxycholecalciferol | ChemIDplus |
| 1α-hydroxy-vitamin D3 | ChemIDplus |
| 1α-hydroxyvitamin D3 | ChemIDplus |
| (5Z,7E)-9,10-seco-5,7,10(19)-cholestatrien-1α,3β-diol | ChemIDplus |
| 9,10-secocholesta-5,7,10(19)-triene-1α,3β-diol | ChEBI |
| Brand Name | Source |
|---|---|
| Alsiodol | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| alfacalcidol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 130 | DrugCentral |
| D01518 | KEGG DRUG |
| DB01436 | DrugBank |
| HMDB0015504 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2064794 | Reaxys |
| CAS:41294-56-8 | ChemIDplus |
| CAS:41294-56-8 | KEGG DRUG |
| Citations |
|---|