EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O5 |
| Net Charge | 0 |
| Average Mass | 448.644 |
| Monoisotopic Mass | 448.31887 |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)[C@@H]([C@H](C)CC(O)CC(C)(O)CO)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H44O5/c1-17(12-22(30)15-26(3,32)16-28)23-9-10-24-19(6-5-11-27(23,24)4)7-8-20-13-21(29)14-25(31)18(20)2/h7-8,17,21-25,28-32H,2,5-6,9-16H2,1,3-4H3/b19-7+,20-8-/t17-,21-,22?,23-,24+,25+,26?,27-/m1/s1 |
| InChIKey | QDZSTMXTBPCCGE-SFWHNGQFSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-alpha 23,25,26-trihydroxy vitamin D3 (CHEBI:233815) has functional parent calciol (CHEBI:28940) |
| 1-alpha 23,25,26-trihydroxy vitamin D3 (CHEBI:233815) has role human metabolite (CHEBI:77746) |
| 1-alpha 23,25,26-trihydroxy vitamin D3 (CHEBI:233815) is a D3 vitamins (CHEBI:73558) |
| 1-alpha 23,25,26-trihydroxy vitamin D3 (CHEBI:233815) is a hydroxycalciol (CHEBI:47042) |
| 1-alpha 23,25,26-trihydroxy vitamin D3 (CHEBI:233815) is a organic molecular entity (CHEBI:50860) |
| 1-alpha 23,25,26-trihydroxy vitamin D3 (CHEBI:233815) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (6R)-6-[(1R,3aS,4E,7aR)-4-{2-[(1Z,3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyl-octahydro-1H-inden-1-yl]-2-methylheptane-1,2,4-triol |
| Citations |
|---|