EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O5 |
| Net Charge | 0 |
| Average Mass | 446.628 |
| Monoisotopic Mass | 446.30322 |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)[C@@H]([C@H](C)CC4CC(C)(O)C(O)O4)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H42O5/c1-16(12-21-15-27(4,31)25(30)32-21)22-9-10-23-18(6-5-11-26(22,23)3)7-8-19-13-20(28)14-24(29)17(19)2/h7-8,16,20-25,28-31H,2,5-6,9-15H2,1,3-4H3/b18-7+,19-8-/t16-,20-,21?,22-,23+,24+,25?,26-,27?/m1/s1 |
| InChIKey | IYBKBIPCYPEBEW-XOIPKNRJSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23S,25R-1-alpha-25-hydroxy vitamin D3-26,23-lactol (CHEBI:233816) has functional parent calciol (CHEBI:28940) |
| 23S,25R-1-alpha-25-hydroxy vitamin D3-26,23-lactol (CHEBI:233816) has role human metabolite (CHEBI:77746) |
| 23S,25R-1-alpha-25-hydroxy vitamin D3-26,23-lactol (CHEBI:233816) is a D3 vitamins (CHEBI:73558) |
| 23S,25R-1-alpha-25-hydroxy vitamin D3-26,23-lactol (CHEBI:233816) is a hydroxycalciol (CHEBI:47042) |
| IUPAC Name |
|---|
| 5-[(2R)-2-[(1R,3aS,4E,7aR)-4-{2-[(1Z,3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyl-octahydro-1H-inden-1-yl]propyl]-3-methyloxolane-2,3-diol |
| Citations |
|---|