EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)[C@@H](O)[C@H](O)C1=C |
| InChI | InChI=1S/C27H44O4/c1-17(8-6-14-26(3,4)31)21-12-13-22-19(9-7-15-27(21,22)5)10-11-20-16-23(28)25(30)24(29)18(20)2/h10-11,17,21-25,28-31H,2,6-9,12-16H2,1,3-5H3/b19-10+,20-11-/t17-,21-,22+,23-,24-,25-,27-/m1/s1 |
| InChIKey | JGIYYEHLYUOKSD-FQKVRLMOSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) has functional parent calciol (CHEBI:28940) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) has role human metabolite (CHEBI:77746) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) is a D3 vitamins (CHEBI:73558) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) is a hydroxy seco-steroid (CHEBI:36853) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) is a seco-cholestane (CHEBI:36818) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) is a secondary alcohol (CHEBI:35681) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) is a steroid hormone (CHEBI:26764) |
| 1α,2β,25-trihydroxy vitamin D3 (CHEBI:87395) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,2R,3R,5Z,7E)-9,10-secocholesta-5,7,10-triene-1,2,3,25-tetrol |
| Synonyms | Source |
|---|---|
| 1α,2β,25-(OH)3 cholecalciferol | SUBMITTER |
| 1α,2β,25(OH)3D3 | ChEBI |
| 1α,2β,25-(OH)3 vitamin D3 | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 1α,2β,25-trihydroxycholecalciferol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8957905 | Reaxys |