EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CC[C@@H](O)C(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C27H44O3/c1-17(2)25(29)13-8-18(3)23-11-12-24-20(7-6-14-27(23,24)5)9-10-21-15-22(28)16-26(30)19(21)4/h9-10,17-18,22-26,28-30H,4,6-8,11-16H2,1-3,5H3/b20-9+,21-10-/t18-,22-,23-,24+,25-,26+,27-/m1/s1 |
| InChIKey | BJYLYJCXYAMOFT-RSFVBTMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vitamin D receptor agonist An agonist that binds to and activates vitamin D receptors fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | antipsoriatic A drug used to treat psoriasis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tacalcitol (CHEBI:32176) has functional parent calciol (CHEBI:28940) |
| tacalcitol (CHEBI:32176) has role antineoplastic agent (CHEBI:35610) |
| tacalcitol (CHEBI:32176) has role antipsoriatic (CHEBI:50748) |
| tacalcitol (CHEBI:32176) has role vitamin D receptor agonist (CHEBI:139503) |
| tacalcitol (CHEBI:32176) is a D3 vitamins (CHEBI:73558) |
| tacalcitol (CHEBI:32176) is a hydroxy seco-steroid (CHEBI:36853) |
| tacalcitol (CHEBI:32176) is a seco-cholestane (CHEBI:36818) |
| tacalcitol (CHEBI:32176) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E,24R)-9,10-secocholesta-5,7,10-triene-1,3,24-triol |
| INNs | Source |
|---|---|
| tacalcitol | WHO MedNet |
| tacalcitol | WHO MedNet |
| tacalcitol | WHO MedNet |
| tacalcitolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1α,24R)-1,24-dihydroxyvitamin D3 | KEGG COMPOUND |
| 1-α,24(R)-dihydroxyvitamin D3 | ChemIDplus |
| PRI 2191 | ChemIDplus |
| PRI-2191 | ChEBI |
| TV 02 | ChemIDplus |
| TV-02 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Bonalfa | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:57333-96-7 | ChemIDplus |
| Citations |
|---|