EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O3 |
| Net Charge | 0 |
| Average Mass | 162.189 |
| Monoisotopic Mass | 162.10044 |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,9-11H,1,7-8H2/t2-,3+,4+,5-,6- |
| InChIKey | DTFAJAKTSMLKAT-JDCCYXBGSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-deoxystreptamine (CHEBI:28295) has functional parent streptamine (CHEBI:27955) |
| 2-deoxystreptamine (CHEBI:28295) has role antibacterial agent (CHEBI:33282) |
| 2-deoxystreptamine (CHEBI:28295) is a amino cyclitol (CHEBI:61689) |
| 2-deoxystreptamine (CHEBI:28295) is conjugate base of 2-deoxystreptamine(1+) (CHEBI:72447) |
| Incoming Relation(s) |
| 2-deoxystreptamine derivative (CHEBI:61800) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-N-acetylparomamine (CHEBI:65018) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-deamino-2'-hydroxy-6'-dehydroparomamine (CHEBI:67225) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-deamino-2'-hydroxyneamine (CHEBI:67223) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 4'-oxolividamine (CHEBI:132423) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| gentamycin 2''-phosphate (CHEBI:142938) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| paromamine (CHEBI:7933) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2-deoxystreptamine(1+) (CHEBI:72447) is conjugate acid of 2-deoxystreptamine (CHEBI:28295) |
| IUPAC Name |
|---|
| (1R,2r,3S,4R,6S)-4,6-diaminocyclohexane-1,2,3-triol |
| Synonyms | Source |
|---|---|
| 2-Deoxystreptamine | KEGG COMPOUND |
| 2-Desoxystreptamine | ChemIDplus |
| 4,6-diamino-1,2,3-cyclohexanetriol | ChemIDplus |
| Deoxystreptamine | ChemIDplus |
| Citations |
|---|