EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N2O3 |
| Net Charge | +1 |
| Average Mass | 163.197 |
| Monoisotopic Mass | 163.10772 |
| SMILES | N[C@@H]1C[C@H]([NH3+])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,9-11H,1,7-8H2/p+1/t2-,3+,4+,5-,6- |
| InChIKey | DTFAJAKTSMLKAT-JDCCYXBGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-deoxystreptamine(1+) (CHEBI:72447) is a ammonium ion derivative (CHEBI:35274) |
| 2-deoxystreptamine(1+) (CHEBI:72447) is a organic cation (CHEBI:25697) |
| 2-deoxystreptamine(1+) (CHEBI:72447) is conjugate acid of 2-deoxystreptamine (CHEBI:28295) |
| 2-deoxystreptamine(1+) (CHEBI:72447) is conjugate base of 2-deoxystreptamine(2+) (CHEBI:65069) |
| Incoming Relation(s) |
| 2-deoxystreptamine(2+) (CHEBI:65069) is conjugate acid of 2-deoxystreptamine(1+) (CHEBI:72447) |
| 2-deoxystreptamine (CHEBI:28295) is conjugate base of 2-deoxystreptamine(1+) (CHEBI:72447) |
| IUPAC Name |
|---|
| (1R,2S,3R,4R,5S)-5-amino-2,3,4-trihydroxycyclohexanaminium |
| Synonyms | Source |
|---|---|
| 2-DEOXY-D-STREPTAMINE | PDBeChem |
| 2-deoxystreptamine monocation | ChEBI |
| 2-deoxystreptaminium(1+) | ChEBI |
| 2-deoxystreptaminium monocation | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NEB | PDBeChem |