EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22N2O8 |
| Net Charge | 0 |
| Average Mass | 322.314 |
| Monoisotopic Mass | 322.13762 |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](C=O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22N2O8/c13-3-1-4(14)11(9(19)6(3)16)22-12-10(20)8(18)7(17)5(2-15)21-12/h2-12,16-20H,1,13-14H2/t3-,4+,5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | NINNJPOSRPHVPI-JCLMPDJQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deamino-2'-hydroxy-6'-dehydroparomamine (CHEBI:67225) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-deamino-2'-hydroxy-6'-dehydroparomamine (CHEBI:67225) is a aldehyde (CHEBI:17478) |
| 2'-deamino-2'-hydroxy-6'-dehydroparomamine (CHEBI:67225) is a amino cyclitol glycoside (CHEBI:22479) |
| 2'-deamino-2'-hydroxy-6'-dehydroparomamine (CHEBI:67225) is conjugate base of 2'-deamino-2'-hydroxy-6'-dehydroparomamine(2+) (CHEBI:67214) |
| Incoming Relation(s) |
| 2'-deamino-2'-hydroxy-6'-dehydroparomamine(2+) (CHEBI:67214) is conjugate acid of 2'-deamino-2'-hydroxy-6'-dehydroparomamine (CHEBI:67225) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl α-D-gluco-hexodialdo-1,5-pyranoside |
| Manual Xrefs | Databases |
|---|---|
| CPD-14156 | MetaCyc |
| Citations |
|---|