EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O8 |
| Net Charge | 0 |
| Average Mass | 324.330 |
| Monoisotopic Mass | 324.15327 |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24N2O8/c13-3-1-4(14)11(9(19)6(3)16)22-12-10(20)8(18)7(17)5(2-15)21-12/h3-12,15-20H,1-2,13-14H2/t3-,4+,5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | KXYGCYIEINSYLN-JCLMPDJQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) is a amino cyclitol glycoside (CHEBI:22479) |
| 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) is conjugate base of 2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) |
| Incoming Relation(s) |
| 2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) is conjugate acid of 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 4-O-(α-D-glucopyranosyl)-2-deoxystreptamine | ChEBI |
| 4-O-(α-D-glucosyl)-2-deoxystreptamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1433324 | Reaxys |