EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25N3O7 |
| Net Charge | 0 |
| Average Mass | 323.346 |
| Monoisotopic Mass | 323.16925 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H25N3O7/c13-2-5-7(17)8(18)10(20)12(21-5)22-11-4(15)1-3(14)6(16)9(11)19/h3-12,16-20H,1-2,13-15H2/t3-,4+,5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | AWRLKTYNEGEURZ-JCLMPDJQSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deamino-2'-hydroxyneamine (CHEBI:67223) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 2'-deamino-2'-hydroxyneamine (CHEBI:67223) has role antimicrobial agent (CHEBI:33281) |
| 2'-deamino-2'-hydroxyneamine (CHEBI:67223) is a amino cyclitol glycoside (CHEBI:22479) |
| 2'-deamino-2'-hydroxyneamine (CHEBI:67223) is conjugate base of 2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) |
| Incoming Relation(s) |
| 2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) is conjugate acid of 2'-deamino-2'-hydroxyneamine (CHEBI:67223) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 6-amino-6-deoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 4-O-(6-amino-6-deoxy-α-D-glucopyranosyl)-2-deoxystreptamine | ChEBI |
| Kanamine | ChemIDplus |
| NK 1003 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-14128 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5066965 | Reaxys |
| CAS:31077-71-1 | ChemIDplus |
| Citations |
|---|