EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N3O6 |
| Net Charge | 0 |
| Average Mass | 305.331 |
| Monoisotopic Mass | 305.15869 |
| SMILES | N[C@@H]1CC(=O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](N)C[C@@H]1N |
| InChI | InChI=1S/C12H23N3O6/c13-4-1-5(14)11(10(19)9(4)18)21-12-6(15)2-7(17)8(3-16)20-12/h4-6,8-12,16,18-19H,1-3,13-15H2/t4-,5+,6-,8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | DUGNFLRRNRIJOU-KMMARAAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces tenebrarius (ncbitaxon:1933) | - | PubMed (26879038) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-oxolividamine (CHEBI:132423) has functional parent 2-deoxystreptamine (CHEBI:28295) |
| 4'-oxolividamine (CHEBI:132423) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 4'-oxolividamine (CHEBI:132423) is a aminoglycoside (CHEBI:47779) |
| 4'-oxolividamine (CHEBI:132423) is a primary amino compound (CHEBI:50994) |
| 4'-oxolividamine (CHEBI:132423) is a triamine (CHEBI:38751) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2,3-dideoxy-α-D-erythro-hexopyranosid-4-ulose |
| Synonym | Source |
|---|---|
| 3'-Deoxy-4'-oxoparomamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C21257 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29223127 | Reaxys |
| Citations |
|---|