EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:27997 - elaidic acid
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
| InChIKey | ZQPPMHVWECSIRJ-MDZDMXLPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaidic acid (CHEBI:27997) has parent hydride trans-octadec-9-ene (CHEBI:37607) |
| elaidic acid (CHEBI:27997) has role food component (CHEBI:78295) |
| elaidic acid (CHEBI:27997) is a octadec-9-enoic acid (CHEBI:36021) |
| elaidic acid (CHEBI:27997) is conjugate acid of elaidate (CHEBI:30825) |
| elaidic acid (CHEBI:27997) is conjugate acid of Octadec-9-enoic acid anion (CHEBI:231086) |
| Incoming Relation(s) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) has functional parent elaidic acid (CHEBI:27997) |
| (9E)-12-(phosphonooxy)octadecenoic acid (CHEBI:85136) has functional parent elaidic acid (CHEBI:27997) |
| (9E)-12-hydroxyoctadec-9-enoic acid (CHEBI:85641) has functional parent elaidic acid (CHEBI:27997) |
| (9E)-9-nitrooctadecenoic acid (CHEBI:86329) has functional parent elaidic acid (CHEBI:27997) |
| (9E)-octadec-9-enoylcarnitine (CHEBI:86038) has functional parent elaidic acid (CHEBI:27997) |
| 1-[(9E)-octadecenoyl]glycerol (CHEBI:131342) has functional parent elaidic acid (CHEBI:27997) |
| 1,2-di-(9E-octadecenoyl)-sn-glycero-3-phospho-(1'-sn-glycerol) (CHEBI:84525) has functional parent elaidic acid (CHEBI:27997) |
| 2-[(9E)-9-octadecenoyl]glycerol (CHEBI:131380) has functional parent elaidic acid (CHEBI:27997) |
| cholesteryl elaidate (CHEBI:46902) has functional parent elaidic acid (CHEBI:27997) |
| cystodytin H (CHEBI:65714) has functional parent elaidic acid (CHEBI:27997) |
| cystodytin I (CHEBI:65715) has functional parent elaidic acid (CHEBI:27997) |
| hexadecyl elaidate (CHEBI:84072) has functional parent elaidic acid (CHEBI:27997) |
| ricinelaidic acid (CHEBI:45478) has functional parent elaidic acid (CHEBI:27997) |
| trielaidin (CHEBI:53759) has functional parent elaidic acid (CHEBI:27997) |
| elaidate (CHEBI:30825) is conjugate base of elaidic acid (CHEBI:27997) |
| Octadec-9-enoic acid anion (CHEBI:231086) is conjugate base of elaidic acid (CHEBI:27997) |
| elaidoyl group (CHEBI:23904) is substituent group from elaidic acid (CHEBI:27997) |
| IUPAC Name |
|---|
| (9E)-octadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| (9E)-Octadecenoic acid | KEGG COMPOUND |
| 9-OCTADECENOIC ACID | PDBeChem |
| 9-Octadecenoic acid, (E)- | KEGG COMPOUND |
| 9-trans-Octadecenoic acid | KEGG COMPOUND |
| Acide elaidique | KEGG COMPOUND |
| D9-trans-Octadecenoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01712 | KEGG COMPOUND |
| C01712 | KEGG COMPOUND |
| ELA | PDBeChem |
| Elaidic_acid | Wikipedia |
| HMDB0000573 | HMDB |
| LMFA01030073 | LIPID MAPS |
| Citations |
|---|