EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33NO4 |
| Net Charge | 0 |
| Average Mass | 327.465 |
| Monoisotopic Mass | 327.24096 |
| SMILES | CCCCCCCC/C=C(\CCCCCCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C18H33NO4/c1-2-3-4-5-6-8-11-14-17(19(22)23)15-12-9-7-10-13-16-18(20)21/h14H,2-13,15-16H2,1H3,(H,20,21)/b17-14+ |
| InChIKey | CQOAKBVRRVHWKV-SAPNQHFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS93) | ||
| - | MetaboLights (MTBLS90) | ||
| - | MetaboLights (MTBLS124) | ||
| - | PubMed (25502724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9E)-9-nitrooctadecenoic acid (CHEBI:86329) has functional parent elaidic acid (CHEBI:27997) |
| (9E)-9-nitrooctadecenoic acid (CHEBI:86329) has role human metabolite (CHEBI:77746) |
| (9E)-9-nitrooctadecenoic acid (CHEBI:86329) is a long-chain fatty acid (CHEBI:15904) |
| (9E)-9-nitrooctadecenoic acid (CHEBI:86329) is a monounsaturated fatty acid (CHEBI:25413) |
| (9E)-9-nitrooctadecenoic acid (CHEBI:86329) is a nitro fatty acid (CHEBI:86286) |
| Incoming Relation(s) |
| 9-nitroelaidate (CHEBI:747188) is conjugate base of (9E)-9-nitrooctadecenoic acid (CHEBI:86329) |
| IUPAC Name |
|---|
| (9E)-9-nitrooctadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 9-nitro-9E-octadecenoic acid | LIPID MAPS |
| (E)-9-nitrooctadec-9-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01120004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10378656 | Reaxys |
| Citations |
|---|