EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33NO4 |
| Net Charge | 0 |
| Average Mass | 327.465 |
| Monoisotopic Mass | 327.24096 |
| SMILES | CCCCCCCC/C(=C\CCCCCCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C18H33NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h15H,2-14,16H2,1H3,(H,20,21)/b17-15+ |
| InChIKey | WRADPCFZZWXOTI-BMRADRMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS90) | ||
| - | MetaboLights (MTBLS124) | ||
| - | MetaboLights (MTBLS93) | ||
| - | PubMed (25502724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) has functional parent elaidic acid (CHEBI:27997) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) has role anti-asthmatic agent (CHEBI:65023) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) has role antihypertensive agent (CHEBI:35674) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) has role human metabolite (CHEBI:77746) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) has role renoprotective agent (CHEBI:231911) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) is a long-chain fatty acid (CHEBI:15904) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) is a monounsaturated fatty acid (CHEBI:25413) |
| (9E)-10-nitrooctadecenoic acid (CHEBI:86285) is a nitro fatty acid (CHEBI:86286) |
| Incoming Relation(s) |
| 10-nitroelaidate (CHEBI:747187) is conjugate base of (9E)-10-nitrooctadecenoic acid (CHEBI:86285) |
| IUPAC Name |
|---|
| (9E)-10-nitrooctadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 10-nitro-9E-octadecenoic acid | LIPID MAPS |
| 10-nitroelaidic acid | ChEBI |
| 10-nitro-oleic acid | ChEMBL |
| cxa-10 | ChEMBL |
| CXA-10 | ChEMBL |
| E-10-no2-18:1 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LMFA01120003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10378886 | Reaxys |
| Citations |
|---|