EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:36021 - octadec-9-enoic acid
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | [H]C(CCCCCCCC)=C([H])CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20) |
| InChIKey | ZQPPMHVWECSIRJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS93) | ||
| - | MetaboLights (MTBLS124) | ||
| - | MetaboLights (MTBLS90) | ||
| - | PubMed (25502724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octadec-9-enoic acid (CHEBI:36021) has parent hydride octadec-9-ene (CHEBI:37605) |
| octadec-9-enoic acid (CHEBI:36021) has role plant metabolite (CHEBI:76924) |
| octadec-9-enoic acid (CHEBI:36021) is a octadecenoic acid (CHEBI:25634) |
| octadec-9-enoic acid (CHEBI:36021) is conjugate acid of octadec-9-enoate (CHEBI:132944) |
| Incoming Relation(s) |
| N-(2-hydroxy-1-methylethyl)-9-octadecenamide (CHEBI:90125) has functional parent octadec-9-enoic acid (CHEBI:36021) |
| 1-octadec-9-enoylglycero-3-phosphate (CHEBI:52288) has functional parent octadec-9-enoic acid (CHEBI:36021) |
| sterculic acid (CHEBI:9261) has functional parent octadec-9-enoic acid (CHEBI:36021) |
| vernolic acid (CHEBI:38299) has functional parent octadec-9-enoic acid (CHEBI:36021) |
| elaidic acid (CHEBI:27997) is a octadec-9-enoic acid (CHEBI:36021) |
| oleic acid (CHEBI:16196) is a octadec-9-enoic acid (CHEBI:36021) |
| octadec-9-enoate (CHEBI:132944) is conjugate base of octadec-9-enoic acid (CHEBI:36021) |
| octadec-9-enoyl group (CHEBI:50500) is substituent group from octadec-9-enoic acid (CHEBI:36021) |
| IUPAC Name |
|---|
| octadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 18:1, n-9 | ChEBI |
| 9-octadecenoic acid | ChEBI |
| C18:1, n-9 | ChEBI |
| Δ9-octadecenoic acid | ChemIDplus |
| Citations |
|---|