EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:18237 - glutamic acid
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | WHUUTDBJXJRKMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutamic acid (CHEBI:18237) has part 2-carboxyethyl group (CHEBI:50329) |
| glutamic acid (CHEBI:18237) has role fundamental metabolite (CHEBI:78675) |
| glutamic acid (CHEBI:18237) is a polar amino acid (CHEBI:26167) |
| glutamic acid (CHEBI:18237) is a α-amino acid (CHEBI:33704) |
| glutamic acid (CHEBI:18237) is conjugate acid of glutamate(1−) (CHEBI:14321) |
| Incoming Relation(s) |
| glutamic acid derivative (CHEBI:24315) has functional parent glutamic acid (CHEBI:18237) |
| γ-Glu-Leu (CHEBI:68433) has functional parent glutamic acid (CHEBI:18237) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) has functional parent glutamic acid (CHEBI:18237) |
| γ-glutamylphenylalanine (CHEBI:82966) has functional parent glutamic acid (CHEBI:18237) |
| γ-glutamylthreonine (CHEBI:82968) has functional parent glutamic acid (CHEBI:18237) |
| γGluCys(IAN)Glu (CHEBI:64978) has functional parent glutamic acid (CHEBI:18237) |
| D-glutamic acid (CHEBI:15966) is a glutamic acid (CHEBI:18237) |
| L-glutamic acid (CHEBI:16015) is a glutamic acid (CHEBI:18237) |
| glutamate(1−) (CHEBI:14321) is conjugate base of glutamic acid (CHEBI:18237) |
| glutamic acid residue (CHEBI:32483) is substituent group from glutamic acid (CHEBI:18237) |
| glutamo group (CHEBI:24321) is substituent group from glutamic acid (CHEBI:18237) |
| glutamoyl group (CHEBI:24322) is substituent group from glutamic acid (CHEBI:18237) |
| α-glutamyl group (CHEBI:22453) is substituent group from glutamic acid (CHEBI:18237) |
| γ-glutamyl group (CHEBI:24190) is substituent group from glutamic acid (CHEBI:18237) |
| IUPAC Names |
|---|
| 2-aminopentanedioic acid |
| glutamic acid |
| Synonyms | Source |
|---|---|
| 2-Aminoglutaric acid | KEGG COMPOUND |
| DL-Glutamic acid | KEGG DRUG |
| DL-Glutaminic acid | KEGG COMPOUND |
| E | ChEBI |
| Glu | ChEBI |
| Glutamate | KEGG COMPOUND |
| Citations |
|---|