EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O5 |
| Net Charge | 0 |
| Average Mass | 260.290 |
| Monoisotopic Mass | 260.13722 |
| SMILES | CC(C)C[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | MYFMARDICOWMQP-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (21886157) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Leu (CHEBI:68433) has functional parent glutamic acid (CHEBI:18237) |
| γ-Glu-Leu (CHEBI:68433) has functional parent leucine (CHEBI:25017) |
| γ-Glu-Leu (CHEBI:68433) has role human metabolite (CHEBI:77746) |
| γ-Glu-Leu (CHEBI:68433) is a glutamyl-L-amino acid (CHEBI:24323) |
| γ-Glu-Leu (CHEBI:68433) is conjugate acid of γ-Glu-Leu(1−) (CHEBI:133038) |
| Incoming Relation(s) |
| γ-Glu-Leu(1−) (CHEBI:133038) is conjugate base of γ-Glu-Leu (CHEBI:68433) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-leucine |
| Synonym | Source |
|---|---|
| L-γ-Glu-L-Leu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011171 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729264 | Reaxys |
| CAS:2566-39-4 | ChemIDplus |
| Citations |
|---|