EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O6 |
| Net Charge | 0 |
| Average Mass | 248.235 |
| Monoisotopic Mass | 248.10084 |
| SMILES | CC(O)C(NC(=O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O6/c1-4(12)7(9(16)17)11-6(13)3-2-5(10)8(14)15/h4-5,7,12H,2-3,10H2,1H3,(H,11,13)(H,14,15)(H,16,17) |
| InChIKey | GWNXFCYUJXASDX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-glutamylthreonine (CHEBI:82968) has functional parent glutamic acid (CHEBI:18237) |
| γ-glutamylthreonine (CHEBI:82968) has functional parent threonine (CHEBI:26986) |
| γ-glutamylthreonine (CHEBI:82968) has role human metabolite (CHEBI:77746) |
| γ-glutamylthreonine (CHEBI:82968) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| L-γ-Glu-L-Thr (CHEBI:133747) is a γ-glutamylthreonine (CHEBI:82968) |
| IUPAC Name |
|---|
| γ-glutamylthreonine |
| Synonym | Source |
|---|---|
| γ-Glu-Thr | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029159 | HMDB |
| US2009239808 | Patent |
| Citations |
|---|