EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O5 |
| Net Charge | 0 |
| Average Mass | 294.307 |
| Monoisotopic Mass | 294.12157 |
| SMILES | NC(CCC(=O)NC(Cc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O5/c15-10(13(18)19)6-7-12(17)16-11(14(20)21)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | XHHOHZPNYFQJKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-glutamylphenylalanine (CHEBI:82966) has functional parent glutamic acid (CHEBI:18237) |
| γ-glutamylphenylalanine (CHEBI:82966) has functional parent phenylalanine (CHEBI:28044) |
| γ-glutamylphenylalanine (CHEBI:82966) has role human metabolite (CHEBI:77746) |
| γ-glutamylphenylalanine (CHEBI:82966) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| γ-glutamylphenylalanine |
| Synonym | Source |
|---|---|
| γ-Glu-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029156 | HMDB |
| Citations |
|---|