EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5Se |
| Net Charge | 0 |
| Average Mass | 311.196 |
| Monoisotopic Mass | 312.02244 |
| SMILES | C[Se]CC(NC(=O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5Se/c1-17-4-6(9(15)16)11-7(12)3-2-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | IEFQLTYCECVOLL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium cepa (ncbitaxon:4679) | bulb (BTO:0000159) | PubMed (16161771) | |
| Allium sativum (ncbitaxon:4682) | bulb (BTO:0000159) | PubMed (16161771) | |
| Allium tuberosum (ncbitaxon:4683) | - | PubMed (14745183) | Detected in sprouts of Chinese chives. |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) has functional parent Se-methylselenocysteine (CHEBI:9068) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) has functional parent glutamic acid (CHEBI:18237) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) has role antineoplastic agent (CHEBI:35610) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) has role plant metabolite (CHEBI:76924) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| γ-glutamyl-3-(methylselanyl)alanine |
| Synonyms | Source |
|---|---|
| 5-glutamyl-Se-methylselenocysteine | ChEBI |
| γ-glutamyl-Se-methylselenocysteine | KEGG COMPOUND |
| γ-glutamyl-SeMC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05695 | KEGG COMPOUND |
| FDB027866 | FooDB |
| HMDB0010716 | HMDB |
| Citations |
|---|