EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:17822 - serine
| Formula | C3H7NO3 |
| Net Charge | 0 |
| Average Mass | 105.093 |
| Monoisotopic Mass | 105.04259 |
| SMILES | NC(CO)C(=O)O |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
| InChIKey | MTCFGRXMJLQNBG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serine (CHEBI:17822) has part hydroxymethyl group (CHEBI:24712) |
| serine (CHEBI:17822) has role fundamental metabolite (CHEBI:78675) |
| serine (CHEBI:17822) is a polar amino acid (CHEBI:26167) |
| serine (CHEBI:17822) is a α-amino acid (CHEBI:33704) |
| serine (CHEBI:17822) is conjugate acid of serinate (CHEBI:32845) |
| serine (CHEBI:17822) is conjugate base of serinium (CHEBI:32846) |
| serine (CHEBI:17822) is tautomer of serine zwitterion (CHEBI:35243) |
| Incoming Relation(s) |
| N-(2,4-dinitrophenyl)serine (CHEBI:53083) has functional parent serine (CHEBI:17822) |
| 3-oxoalanine (CHEBI:17740) has functional parent serine (CHEBI:17822) |
| gougerotin (CHEBI:156351) has functional parent serine (CHEBI:17822) |
| serine derivative (CHEBI:26649) has functional parent serine (CHEBI:17822) |
| D-serine (CHEBI:16523) is a serine (CHEBI:17822) |
| L-serine (CHEBI:17115) is a serine (CHEBI:17822) |
| serinium (CHEBI:32846) is conjugate acid of serine (CHEBI:17822) |
| serinate (CHEBI:32845) is conjugate base of serine (CHEBI:17822) |
| serine residue (CHEBI:32848) is substituent group from serine (CHEBI:17822) |
| serino group (CHEBI:32847) is substituent group from serine (CHEBI:17822) |
| seryl group (CHEBI:37901) is substituent group from serine (CHEBI:17822) |
| serine zwitterion (CHEBI:35243) is tautomer of serine (CHEBI:17822) |
| IUPAC Name |
|---|
| serine |
| Synonyms | Source |
|---|---|
| 2-amino-3-hydroxypropanoic acid | IUPAC |
| 2-Amino-3-hydroxypropionic acid | KEGG COMPOUND |
| 3-Hydroxyalanine | KEGG COMPOUND |
| Serin | ChEBI |
| Serine | KEGG COMPOUND |
| Serine | KEGG COMPOUND |