EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO3 |
| Net Charge | 0 |
| Average Mass | 105.093 |
| Monoisotopic Mass | 105.04259 |
| SMILES | N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | MTCFGRXMJLQNBG-UWTATZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. fundamental metabolite Any metabolite produced by all living cells. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-serine (CHEBI:16523) has role Escherichia coli metabolite (CHEBI:76971) |
| D-serine (CHEBI:16523) has role antipsychotic agent (CHEBI:35476) |
| D-serine (CHEBI:16523) has role human metabolite (CHEBI:77746) |
| D-serine (CHEBI:16523) has role NMDA receptor agonist (CHEBI:64571) |
| D-serine (CHEBI:16523) is a D-α-amino acid (CHEBI:16733) |
| D-serine (CHEBI:16523) is a serine (CHEBI:17822) |
| D-serine (CHEBI:16523) is conjugate acid of D-serinate (CHEBI:32840) |
| D-serine (CHEBI:16523) is conjugate base of D-serinium (CHEBI:32841) |
| D-serine (CHEBI:16523) is enantiomer of L-serine (CHEBI:17115) |
| D-serine (CHEBI:16523) is tautomer of D-serine zwitterion (CHEBI:35247) |
| Incoming Relation(s) |
| D-serine derivative (CHEBI:84133) has functional parent D-serine (CHEBI:16523) |
| D-serinium (CHEBI:32841) is conjugate acid of D-serine (CHEBI:16523) |
| D-serinate (CHEBI:32840) is conjugate base of D-serine (CHEBI:16523) |
| L-serine (CHEBI:17115) is enantiomer of D-serine (CHEBI:16523) |
| D-serine residue (CHEBI:29998) is substituent group from D-serine (CHEBI:16523) |
| D-serino group (CHEBI:32843) is substituent group from D-serine (CHEBI:16523) |
| D-seryl group (CHEBI:32842) is substituent group from D-serine (CHEBI:16523) |
| D-serine zwitterion (CHEBI:35247) is tautomer of D-serine (CHEBI:16523) |
| IUPAC Name |
|---|
| D-serine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-hydroxypropanoic acid | IUPAC |
| (d)-serine | ChEMBL |
| (d)-serine | ChEMBL |
| D-Serine | KEGG COMPOUND |
| D-SERINE | PDBeChem |
| DSN | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00740 | KEGG COMPOUND |
| DB03929 | DrugBank |
| D-SERINE | MetaCyc |
| DSN | PDBeChem |
| ECMDB03406 | ECMDB |
| HMDB0003406 | HMDB |
| YMDB00284 | YMDB |
| Citations |
|---|