EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO3 |
| Net Charge | 0 |
| Average Mass | 103.077 |
| Monoisotopic Mass | 103.02694 |
| SMILES | [H]C(=O)C(N)C(=O)O |
| InChI | InChI=1S/C3H5NO3/c4-2(1-5)3(6)7/h1-2H,4H2,(H,6,7) |
| InChIKey | XMTCKNXTTXDPJX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxoalanine (CHEBI:17740) has functional parent serine (CHEBI:17822) |
| 3-oxoalanine (CHEBI:17740) is a alanine derivative (CHEBI:22278) |
| 3-oxoalanine (CHEBI:17740) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| L-3-oxoalanine (CHEBI:37012) is a 3-oxoalanine (CHEBI:17740) |
| IUPAC Names |
|---|
| 2-amino-3-oxopropanoic acid |
| 3-oxoalanine |
| Synonyms | Source |
|---|---|
| Cα-formylglycine | ChEBI |
| C(α)-formylglycine | ChEBI |
| C-formylglycine | ChEBI |
| FGly | ChEBI |
| α-formylglycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4366399 | Beilstein |