EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N7O8 |
| Net Charge | 0 |
| Average Mass | 443.417 |
| Monoisotopic Mass | 443.17646 |
| SMILES | CNCC(=O)N[C@H](CO)C(=O)N[C@H]1[C@H](O)[C@@H](O)[C@H](n2ccc(N)nc2=O)O[C@@H]1C(N)=O |
| InChI | InChI=1S/C16H25N7O8/c1-19-4-8(25)20-6(5-24)14(29)22-9-10(26)11(27)15(31-12(9)13(18)28)23-3-2-7(17)21-16(23)30/h2-3,6,9-12,15,19,24,26-27H,4-5H2,1H3,(H2,18,28)(H,20,25)(H,22,29)(H2,17,21,30)/t6-,9+,10+,11-,12+,15-/m1/s1 |
| InChIKey | AMNAZJFEONUVTD-QJHHURCWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces graminearus (ncbitaxon:284030) | - | PubMed (23352137) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.3.2.* (aminoacyltransferase) inhibitor An EC 2.3.* (acyltransferase) inhibitor that interferes with the action of any aminoacyltransferase (EC 2.3.2.*). fungicide A substance used to destroy fungal pests. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gougerotin (CHEBI:156351) has functional parent cytosine (CHEBI:16040) |
| gougerotin (CHEBI:156351) has functional parent serine (CHEBI:17822) |
| gougerotin (CHEBI:156351) has role antimicrobial agent (CHEBI:33281) |
| gougerotin (CHEBI:156351) has role bacterial metabolite (CHEBI:76969) |
| gougerotin (CHEBI:156351) has role EC 2.3.2.* (aminoacyltransferase) inhibitor (CHEBI:76877) |
| gougerotin (CHEBI:156351) has role fungicide (CHEBI:24127) |
| gougerotin (CHEBI:156351) has role nucleoside antibiotic (CHEBI:25605) |
| gougerotin (CHEBI:156351) has role protein synthesis inhibitor (CHEBI:48001) |
| gougerotin (CHEBI:156351) is a oligopeptide (CHEBI:25676) |
| gougerotin (CHEBI:156351) is a pyrimidine nucleoside (CHEBI:26440) |
| gougerotin (CHEBI:156351) is a triol (CHEBI:27136) |
| Synonyms | Source |
|---|---|
| aspiculamycin | KNApSAcK |
| asteromycin | KNApSAcK |
| quingfengmycin | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| C00018700 | KNApSAcK |
| Gougerotin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2096-42-6 | ChemIDplus |
| Citations |
|---|