EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9N3O7 |
| Net Charge | 0 |
| Average Mass | 271.185 |
| Monoisotopic Mass | 271.04405 |
| SMILES | O=C(O)C(CO)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O7/c13-4-7(9(14)15)10-6-2-1-5(11(16)17)3-8(6)12(18)19/h1-3,7,10,13H,4H2,(H,14,15) |
| InChIKey | SBQZBOCQYMVLTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,4-dinitrophenyl)serine (CHEBI:53083) has functional parent serine (CHEBI:17822) |
| N-(2,4-dinitrophenyl)serine (CHEBI:53083) has part hydroxymethyl group (CHEBI:24712) |
| N-(2,4-dinitrophenyl)serine (CHEBI:53083) is a C-nitro compound (CHEBI:35716) |
| N-(2,4-dinitrophenyl)serine (CHEBI:53083) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| N-(2,4-dinitrophenyl)serine (CHEBI:53083) is a serine derivative (CHEBI:26649) |
| IUPAC Name |
|---|
| N-(2,4-dinitrophenyl)serine |
| Synonyms | Source |
|---|---|
| DNP-Ser | ChEBI |
| N-(2,4-Dinitrophenyl)-DL-serine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2820650 | Beilstein |
| CAS:10547-30-5 | ChemIDplus |
| Citations |
|---|