EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO3 |
| Net Charge | -1 |
| Average Mass | 104.085 |
| Monoisotopic Mass | 104.03532 |
| SMILES | NC(CO)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/p-1 |
| InChIKey | MTCFGRXMJLQNBG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serinate (CHEBI:32845) has role fundamental metabolite (CHEBI:78675) |
| serinate (CHEBI:32845) is a α-amino-acid anion (CHEBI:33558) |
| serinate (CHEBI:32845) is conjugate base of serine (CHEBI:17822) |
| Incoming Relation(s) |
| D-serinate (CHEBI:32840) is a serinate (CHEBI:32845) |
| L-serinate (CHEBI:32836) is a serinate (CHEBI:32845) |
| serine (CHEBI:17822) is conjugate acid of serinate (CHEBI:32845) |
| IUPAC Name |
|---|
| serinate |
| Synonyms | Source |
|---|---|
| 2-amino-3-hydroxypropanoate | IUPAC |
| serine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:324692 | Gmelin |