EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N7O17P3S |
| Net Charge | 0 |
| Average Mass | 835.616 |
| Monoisotopic Mass | 835.14142 |
| SMILES | CC=CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H40N7O17P3S/c1-4-5-16(34)53-9-8-27-15(33)6-7-28-23(37)20(36)25(2,3)11-46-52(43,44)49-51(41,42)45-10-14-19(48-50(38,39)40)18(35)24(47-14)32-13-31-17-21(26)29-12-30-22(17)32/h4-5,12-14,18-20,24,35-36H,6-11H2,1-3H3,(H,27,33)(H,28,37)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,18-,19-,20+,24-/m1/s1 |
| InChIKey | KFWWCMJSYSSPSK-CITAKDKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| but-2-enoyl-CoA (CHEBI:36926) has functional parent 2-butenoic acid (CHEBI:17217) |
| but-2-enoyl-CoA (CHEBI:36926) has functional parent coenzyme A (CHEBI:15346) |
| but-2-enoyl-CoA (CHEBI:36926) is a butenoyl-CoA (CHEBI:22961) |
| but-2-enoyl-CoA (CHEBI:36926) is conjugate acid of but-2-enoyl-CoA(4−) (CHEBI:58669) |
| Incoming Relation(s) |
| 2-methylcrotonoyl-CoA (CHEBI:15478) has functional parent but-2-enoyl-CoA (CHEBI:36926) |
| 3-methylbut-2-enoyl-CoA (CHEBI:15486) has functional parent but-2-enoyl-CoA (CHEBI:36926) |
| crotonoyl-CoA (CHEBI:15473) is a but-2-enoyl-CoA (CHEBI:36926) |
| but-2-enoyl-CoA(4−) (CHEBI:58669) is conjugate base of but-2-enoyl-CoA (CHEBI:36926) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(but-2-enoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 2-Butenoyl-CoA | KEGG COMPOUND |
| But-2-enoyl-CoA | KEGG COMPOUND |
| Crotonyl-CoA | KEGG COMPOUND |
| S-But-2-enoylcoenzyme A | ChemIDplus |
| trans-But-2-enoyl-CoA | KEGG COMPOUND |