EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O4 |
| Net Charge | 0 |
| Average Mass | 230.219 |
| Monoisotopic Mass | 230.05791 |
| SMILES | [H]C(C([H])=C1C(=O)Cc2ccccc21)=C(O)C(=O)O |
| InChI | InChI=1S/C13H10O4/c14-11(13(16)17)6-5-10-9-4-2-1-3-8(9)7-12(10)15/h1-6,14H,7H2,(H,16,17) |
| InChIKey | XWPYRLHJCKHRRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-(2-oxo-1,3-dihydro-2H-inden-1-ylidene) but-2-enoic acid (CHEBI:19609) has functional parent 2-butenoic acid (CHEBI:17217) |
| 2-hydroxy-4-(2-oxo-1,3-dihydro-2H-inden-1-ylidene) but-2-enoic acid (CHEBI:19609) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxy-4-(2-oxo-1,3-dihydro-2H-inden-1-ylidene) but-2-enoic acid (CHEBI:19609) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 2-hydroxy-4-(2-oxo-1,3-dihydro-2H-inden-1-ylidene) but-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| c0400 | UM-BBD |