EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O2 |
| Net Charge | -1 |
| Average Mass | 85.082 |
| Monoisotopic Mass | 85.02950 |
| SMILES | [H]C(C)=CC(=O)[O-] |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/p-1 |
| InChIKey | LDHQCZJRKDOVOX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| but-2-enoate (CHEBI:36258) is a butenoate (CHEBI:36029) |
| but-2-enoate (CHEBI:36258) is conjugate base of 2-butenoic acid (CHEBI:17217) |
| Incoming Relation(s) |
| 4-(trimethylammonio)but-2-enoate (CHEBI:11946) has functional parent but-2-enoate (CHEBI:36258) |
| crotonate (CHEBI:35899) is a but-2-enoate (CHEBI:36258) |
| isocrotonate (CHEBI:36254) is a but-2-enoate (CHEBI:36258) |
| 2-butenoic acid (CHEBI:17217) is conjugate acid of but-2-enoate (CHEBI:36258) |
| IUPAC Name |
|---|
| but-2-enoate |
| Synonym | Source |
|---|---|
| 2-butenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:324282 | Gmelin |
| Beilstein:3587578 | Beilstein |