EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | NCCCC(=O)O |
| InChI | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
| InChIKey | BTCSSZJGUNDROE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-aminobutyric acid (CHEBI:16865) has functional parent butyric acid (CHEBI:30772) |
| γ-aminobutyric acid (CHEBI:16865) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| γ-aminobutyric acid (CHEBI:16865) has role human metabolite (CHEBI:77746) |
| γ-aminobutyric acid (CHEBI:16865) has role neurotransmitter (CHEBI:25512) |
| γ-aminobutyric acid (CHEBI:16865) has role signalling molecule (CHEBI:62488) |
| γ-aminobutyric acid (CHEBI:16865) is a monocarboxylic acid (CHEBI:25384) |
| γ-aminobutyric acid (CHEBI:16865) is a γ-amino acid (CHEBI:33707) |
| γ-aminobutyric acid (CHEBI:16865) is conjugate acid of γ-aminobutyrate (CHEBI:30566) |
| γ-aminobutyric acid (CHEBI:16865) is tautomer of γ-aminobutyric acid zwitterion (CHEBI:59888) |
| Incoming Relation(s) |
| (1S,2S,5S)-2-(4-glutaridylbenzyl)-5-phenylcyclohexan-1-ol (CHEBI:43278) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| N-acyl-γ-aminobutyric acid (CHEBI:134018) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| 4-(methylamino)butyric acid (CHEBI:37755) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| 4-aminobutanoyl-CoA (CHEBI:15496) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| gabapentin (CHEBI:42797) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| gabapentin enacarbil (CHEBI:68840) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| homocarnosine (CHEBI:28050) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| methyl 4-aminobutanoate (CHEBI:42955) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| pregabalin (CHEBI:64356) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| γ-aminobutyrate (CHEBI:30566) is conjugate base of γ-aminobutyric acid (CHEBI:16865) |
| γ-aminobutyric acid zwitterion (CHEBI:59888) is tautomer of γ-aminobutyric acid (CHEBI:16865) |
| IUPAC Name |
|---|
| 4-aminobutanoic acid |
| Synonyms | Source |
|---|---|
| 4Abu | ChEBI |
| 4-aminobutanoic acid | ChEBI |
| 4-Aminobutanoic acid | KEGG COMPOUND |
| 4-aminobutyric acid | ChEBI |
| 4-Aminobutyric acid | KEGG COMPOUND |
| GABA | IUPHAR |
| Manual Xrefs | Databases |
|---|---|
| 1262 | DrugCentral |
| 2298 | BPDB |
| 4-AMINO-BUTYRATE | MetaCyc |
| ABU | PDBeChem |
| C00001337 | KNApSAcK |
| C00334 | KEGG COMPOUND |
| D00058 | KEGG DRUG |
| DB02530 | DrugBank |
| Gamma-Aminobutyric_acid | Wikipedia |
| HMDB0000112 | HMDB |
| LMFA01100039 | LIPID MAPS |
| Citations |
|---|