EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO6 |
| Net Charge | 0 |
| Average Mass | 329.393 |
| Monoisotopic Mass | 329.18384 |
| SMILES | CC(OC(=O)NCC1(CC(=O)O)CCCCC1)OC(=O)C(C)C |
| InChI | InChI=1S/C16H27NO6/c1-11(2)14(20)22-12(3)23-15(21)17-10-16(9-13(18)19)7-5-4-6-8-16/h11-12H,4-10H2,1-3H3,(H,17,21)(H,18,19) |
| InChIKey | TZDUHAJSIBHXDL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gabapentin enacarbil (CHEBI:68840) has functional parent gabapentin (CHEBI:42797) |
| gabapentin enacarbil (CHEBI:68840) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| gabapentin enacarbil (CHEBI:68840) has role anticonvulsant (CHEBI:35623) |
| gabapentin enacarbil (CHEBI:68840) has role calcium channel blocker (CHEBI:38215) |
| gabapentin enacarbil (CHEBI:68840) has role prodrug (CHEBI:50266) |
| gabapentin enacarbil (CHEBI:68840) is a acetal (CHEBI:59769) |
| gabapentin enacarbil (CHEBI:68840) is a carbamate ester (CHEBI:23003) |
| gabapentin enacarbil (CHEBI:68840) is a carboxylic ester (CHEBI:33308) |
| gabapentin enacarbil (CHEBI:68840) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| {1-[({[1-(isobutyryloxy)ethoxy]carbonyl}amino)methyl]cyclohexyl}acetic acid |
| INNs | Source |
|---|---|
| gabapentina enacarbilo | WHO MedNet |
| gabapentine enacarbil | WHO MedNet |
| gabapentin enacarbil | KEGG DRUG |
| gabapentinum enacarbilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| XP 13512 | ChemIDplus |
| XP-13512 | ChemIDplus |
| XP13512 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Horizant | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4177 | DrugCentral |
| Gabapentin_enacarbil | Wikipedia |
| US2006229361 | Patent |
| US2007049626 | Patent |
| WO2005037784 | Patent |
| WO2005066122 | Patent |
| WO2006050514 | Patent |
| WO2008073257 | Patent |
| WO2010063002 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10188772 | Reaxys |
| CAS:478296-72-9 | ChemIDplus |
| Citations |
|---|