EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O3 |
| Net Charge | 0 |
| Average Mass | 240.263 |
| Monoisotopic Mass | 240.12224 |
| SMILES | NCCCC(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c11-3-1-2-9(15)14-8(10(16)17)4-7-5-12-6-13-7/h5-6,8H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | CCLQKVKJOGVQLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homocarnosine (CHEBI:28050) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| homocarnosine (CHEBI:28050) has role metabolite (CHEBI:25212) |
| homocarnosine (CHEBI:28050) is a N-acyl-amino acid (CHEBI:51569) |
| homocarnosine (CHEBI:28050) is a histidine derivative (CHEBI:24599) |
| homocarnosine (CHEBI:28050) is a imidazoles (CHEBI:24780) |
| Incoming Relation(s) |
| L-homocarnosine (CHEBI:85981) is a homocarnosine (CHEBI:28050) |
| IUPAC Name |
|---|
| N-(4-aminobutanoyl)histidine |
| Synonyms | Source |
|---|---|
| N-(4-aminobutyryl)histidine | ChEBI |
| gamma-Aminobutyryl histidine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11612459 | Reaxys |