EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:64356 - pregabalin
| Formula | C8H17NO2 |
| Net Charge | 0 |
| Average Mass | 159.229 |
| Monoisotopic Mass | 159.12593 |
| SMILES | CC(C)C[C@H](CN)CC(=O)O |
| InChI | InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | AYXYPKUFHZROOJ-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anticonvulsant A drug used to prevent seizures or reduce their severity. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pregabalin (CHEBI:64356) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| pregabalin (CHEBI:64356) has role analgesic (CHEBI:35480) |
| pregabalin (CHEBI:64356) has role anticonvulsant (CHEBI:35623) |
| pregabalin (CHEBI:64356) has role antidepressant (CHEBI:35469) |
| pregabalin (CHEBI:64356) has role antiemetic (CHEBI:50919) |
| pregabalin (CHEBI:64356) has role antineoplastic agent (CHEBI:35610) |
| pregabalin (CHEBI:64356) has role antipsychotic agent (CHEBI:35476) |
| pregabalin (CHEBI:64356) has role antispasmodic drug (CHEBI:53784) |
| pregabalin (CHEBI:64356) has role antitussive (CHEBI:51177) |
| pregabalin (CHEBI:64356) has role anxiolytic drug (CHEBI:35474) |
| pregabalin (CHEBI:64356) has role calcium channel blocker (CHEBI:38215) |
| pregabalin (CHEBI:64356) has role hypoglycemic agent (CHEBI:35526) |
| pregabalin (CHEBI:64356) has role ophthalmology drug (CHEBI:66981) |
| pregabalin (CHEBI:64356) is a γ-amino acid (CHEBI:33707) |
| IUPAC Name |
|---|
| (3S)-3-(aminomethyl)-5-methylhexanoic acid |
| INNs | Source |
|---|---|
| pregabalin | KEGG DRUG |
| pregabalina | WHO MedNet |
| pregabaline | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-Isobutyl GABA | ChemIDplus |
| CI-1008 | ChEMBL |
| NSC-759256 | ChEMBL |
| PD-144723 | ChEMBL |
| Pregabalin mylan | ChEMBL |
| Pregabalin sandoz | ChEMBL |
| Brand Names | Source |
|---|---|
| Alzain | ChEMBL |
| Axalid | ChEMBL |
| Bonqat | ChEMBL |
| Lecaent | ChEMBL |
| Lyrica | KEGG DRUG |
| Lyrica cr | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2255 | DrugCentral |
| D02716 | KEGG DRUG |
| DB00230 | DrugBank |
| EP1178034 | Patent |
| EP2418194 | Patent |
| Pregabalin | Wikipedia |
| US2008311635 | Patent |
| US6359169 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8404778 | Reaxys |
| CAS:148553-50-8 | ChemIDplus |
| CAS:148553-50-8 | KEGG DRUG |
| Citations |
|---|