EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO2 |
| Net Charge | 0 |
| Average Mass | 159.229 |
| Monoisotopic Mass | 159.12593 |
| SMILES | CC(C)C[C@H](CN)CC(=O)O |
| InChI | InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | AYXYPKUFHZROOJ-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pregabalin (CHEBI:64356) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| pregabalin (CHEBI:64356) has role anticonvulsant (CHEBI:35623) |
| pregabalin (CHEBI:64356) has role calcium channel blocker (CHEBI:38215) |
| pregabalin (CHEBI:64356) is a γ-amino acid (CHEBI:33707) |
| IUPAC Name |
|---|
| (3S)-3-(aminomethyl)-5-methylhexanoic acid |
| INN | Source |
|---|---|
| pregabalin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3-Isobutyl GABA | ChemIDplus |
| (S)-3-Isobutyl GABA | ChemIDplus |
| Brand Name | Source |
|---|---|
| Lyrica | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2255 | DrugCentral |
| D02716 | KEGG DRUG |
| DB00230 | DrugBank |
| EP1178034 | Patent |
| EP2418194 | Patent |
| Pregabalin | Wikipedia |
| US2008311635 | Patent |
| US6359169 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8404778 | Reaxys |
| CAS:148553-50-8 | ChemIDplus |
| CAS:148553-50-8 | KEGG DRUG |
| Citations |
|---|