EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO2 |
| Net Charge | 0 |
| Average Mass | 171.240 |
| Monoisotopic Mass | 171.12593 |
| SMILES | NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12) |
| InChIKey | UGJMXCAKCUNAIE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gabapentin (CHEBI:42797) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| gabapentin (CHEBI:42797) has role anticonvulsant (CHEBI:35623) |
| gabapentin (CHEBI:42797) has role calcium channel blocker (CHEBI:38215) |
| gabapentin (CHEBI:42797) has role environmental contaminant (CHEBI:78298) |
| gabapentin (CHEBI:42797) has role xenobiotic (CHEBI:35703) |
| gabapentin (CHEBI:42797) is a γ-amino acid (CHEBI:33707) |
| Incoming Relation(s) |
| gabapentin enacarbil (CHEBI:68840) has functional parent gabapentin (CHEBI:42797) |
| IUPAC Name |
|---|
| [1-(aminomethyl)cyclohexyl]acetic acid |
| INNs | Source |
|---|---|
| gabapentin | KEGG DRUG |
| gabapentina | WHO MedNet |
| gabapentine | DrugBank |
| gabapentinum | DrugBank |
| Synonym | Source |
|---|---|
| 1-(Aminomethyl)cyclohexaneacetic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Neurontin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1264 | DrugCentral |
| 2975 | VSDB |
| D00332 | KEGG DRUG |
| DB00996 | DrugBank |
| EP1140793 | Patent |
| Gabapentin | Wikipedia |
| GBN | PDBeChem |
| HMDB0005015 | HMDB |
| LSM-5716 | LINCS |
| US2008103334 | Patent |
| US2008269326 | Patent |
| US2009043126 | Patent |
| US2009292138 | Patent |
| US2012046272 | Patent |
| WO2005037784 | Patent |
| WO2008060572 | Patent |
| WO2010023694 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2359739 | Reaxys |
| CAS:60142-96-3 | KEGG DRUG |
| CAS:60142-96-3 | ChemIDplus |
| Citations |
|---|