EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CNCCCC(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-6-4-2-3-5(7)8/h6H,2-4H2,1H3,(H,7,8) |
| InChIKey | AOKCDAVWJLOAHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(methylamino)butyric acid (CHEBI:37755) has functional parent butyric acid (CHEBI:30772) |
| 4-(methylamino)butyric acid (CHEBI:37755) has functional parent γ-aminobutyric acid (CHEBI:16865) |
| 4-(methylamino)butyric acid (CHEBI:37755) is a γ-amino acid (CHEBI:33707) |
| 4-(methylamino)butyric acid (CHEBI:37755) is conjugate acid of 4-(methylamino)butyrate (CHEBI:20441) |
| 4-(methylamino)butyric acid (CHEBI:37755) is tautomer of 4-(methylamino)butyric acid zwitterion (CHEBI:66882) |
| Incoming Relation(s) |
| 4-(methylamino)butyrate (CHEBI:20441) is conjugate base of 4-(methylamino)butyric acid (CHEBI:37755) |
| 4-(methylamino)butyric acid zwitterion (CHEBI:66882) is tautomer of 4-(methylamino)butyric acid (CHEBI:37755) |
| IUPAC Name |
|---|
| 4-(methylamino)butanoic acid |
| Synonyms | Source |
|---|---|
| 4-(N-methylamino)butyric acid | ChEBI |
| 4-Methylamino-buttersäure | ChEBI |
| gamma-N-Methylaminobutyrate | KEGG COMPOUND |
| γ-methylaminobutyric acid | ChEBI |