EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16411 - indole-3-acetic acid
| Formula | C10H9NO2 |
| Net Charge | 0 |
| Average Mass | 175.187 |
| Monoisotopic Mass | 175.06333 |
| SMILES | O=C(O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13) |
| InChIKey | SEOVTRFCIGRIMH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). auxin Any of a group of compounds, both naturally occurring and synthetic, that induce cell elongation in plant stems (from Greek αυξανω, "to grow"). plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-acetic acid (CHEBI:16411) has role auxin (CHEBI:22676) |
| indole-3-acetic acid (CHEBI:16411) has role human metabolite (CHEBI:77746) |
| indole-3-acetic acid (CHEBI:16411) has role mouse metabolite (CHEBI:75771) |
| indole-3-acetic acid (CHEBI:16411) has role plant hormone (CHEBI:37848) |
| indole-3-acetic acid (CHEBI:16411) has role plant metabolite (CHEBI:76924) |
| indole-3-acetic acid (CHEBI:16411) is a indole-3-acetic acids (CHEBI:24803) |
| indole-3-acetic acid (CHEBI:16411) is a monocarboxylic acid (CHEBI:25384) |
| indole-3-acetic acid (CHEBI:16411) is conjugate acid of indole-3-acetate (CHEBI:30854) |
| Incoming Relation(s) |
| N-(indol-3-ylacetyl)glutamine (CHEBI:70811) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)-L-aspartic acid (CHEBI:21484) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)glutamic acid (CHEBI:136547) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)leucine (CHEBI:133521) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)phenylalanine (CHEBI:133527) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)valine (CHEBI:133561) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) has functional parent indole-3-acetic acid (CHEBI:16411) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has functional parent indole-3-acetic acid (CHEBI:16411) |
| indol-3-ylacetyl-CoA (CHEBI:12755) has functional parent indole-3-acetic acid (CHEBI:16411) |
| indoleacetic acid conjugate (CHEBI:64631) has functional parent indole-3-acetic acid (CHEBI:16411) |
| methyl (indol-3-yl)acetate (CHEBI:72782) has functional parent indole-3-acetic acid (CHEBI:16411) |
| 3-(3-hydroxy-2-oxo-2,3-dihydro-1H-indol-3-yl)-L-alanine (CHEBI:195384) is a indole-3-acetic acid (CHEBI:16411) |
| indole-3-acetate (CHEBI:30854) is conjugate base of indole-3-acetic acid (CHEBI:16411) |
| IUPAC Name |
|---|
| 1H-indol-3-ylacetic acid |
| Synonyms | Source |
|---|---|
| Indole-3-acetic acid | KEGG COMPOUND |
| Indoleacetic acid | KEGG COMPOUND |
| heteroauxin | NIST Chemistry WebBook |
| IAA | NIST Chemistry WebBook |
| 3-Indolylessigsäure | ChEBI |
| IES | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00954 | KEGG COMPOUND |
| C00954 | KEGG COMPOUND |
| Indole-3-acetic_acid | Wikipedia |
| DB07950 | DrugBank |
| HMDB0000197 | HMDB |
| IAC | PDBeChem |
| C00000100 | KNApSAcK |
| 1106 | BPDB |
| Citations |
|---|