EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O4 |
| Net Charge | 0 |
| Average Mass | 338.363 |
| Monoisotopic Mass | 338.12666 |
| SMILES | O=C(Cc1cnc2cc(O)ccc12)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H18N2O4/c22-14-6-7-15-13(11-20-16(15)10-14)9-18(23)21-17(19(24)25)8-12-4-2-1-3-5-12/h1-7,10-11,17,20,22H,8-9H2,(H,21,23)(H,24,25) |
| InChIKey | XYOSMXFVURVKBE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) is a N-acyl-amino acid (CHEBI:51569) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) is a hydroxyindoles (CHEBI:84729) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) is a phenylalanine derivative (CHEBI:25985) |
| N-[(6-hydroxyindol-3-yl)acetyl]phenylalanine (CHEBI:136939) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[(6-hydroxy-1H-indol-3-yl)acetyl]phenylalanine |
| Synonyms | Source |
|---|---|
| (6-hydroxyindol-3-yl)acetylphenylalanine | ChEBI |
| 6-hydroxyindole-3-acetylphenylalanine | ChEBI |
| N-(6-hydroxyinol-3-ylacetyl)phenylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31825506 | Reaxys |