EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO2 |
| Net Charge | 0 |
| Average Mass | 279.339 |
| Monoisotopic Mass | 279.12593 |
| SMILES | O=C(Cc1cnc2ccccc12)OCCc1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c20-18(21-11-10-14-6-2-1-3-7-14)12-15-13-19-17-9-5-4-8-16(15)17/h1-9,13,19H,10-12H2 |
| InChIKey | IRHVVAKMDAHHAI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum gloeosporioides (ncbitaxon:474922) | - | PubMed (25421415) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has functional parent 2-phenylethanol (CHEBI:49000) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has functional parent indole-3-acetic acid (CHEBI:16411) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has role antifungal agent (CHEBI:35718) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has role fungal metabolite (CHEBI:76946) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) is a carboxylic ester (CHEBI:33308) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 2-phenylethyl 1H-indol-3-ylacetate |
| Synonym | Source |
|---|---|
| 2-phenylethyl 1H-indol-3-yl-acetate | ChEBI |
| Citations |
|---|