EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO2 |
| Net Charge | 0 |
| Average Mass | 279.339 |
| Monoisotopic Mass | 279.12593 |
| SMILES | O=C(Cc1cnc2ccccc12)OCCc1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c20-18(21-11-10-14-6-2-1-3-7-14)12-15-13-19-17-9-5-4-8-16(15)17/h1-9,13,19H,10-12H2 |
| InChIKey | IRHVVAKMDAHHAI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum gloeosporioides (ncbitaxon:474922) | - | PubMed (25421415) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has functional parent 2-phenylethanol (CHEBI:49000) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has functional parent indole-3-acetic acid (CHEBI:16411) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has role antifungal agent (CHEBI:35718) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) has role fungal metabolite (CHEBI:76946) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) is a carboxylic ester (CHEBI:33308) |
| 2-phenylethyl 1H-indol-3-ylacetate (CHEBI:141317) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 2-phenylethyl 1H-indol-3-ylacetate |
| Synonym | Source |
|---|---|
| 2-phenylethyl 1H-indol-3-yl-acetate | ChEBI |
| Citations |
|---|