EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133521 - N-(indole-3-acetyl)leucine
| Formula | C16H20N2O3 |
| Net Charge | 0 |
| Average Mass | 288.347 |
| Monoisotopic Mass | 288.14739 |
| SMILES | CC(C)CC(NC(=O)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)7-14(16(20)21)18-15(19)8-11-9-17-13-6-4-3-5-12(11)13/h3-6,9-10,14,17H,7-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | HCZNPUHZYPPINM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indole-3-acetyl)leucine (CHEBI:133521) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)leucine (CHEBI:133521) has role plant metabolite (CHEBI:76924) |
| N-(indole-3-acetyl)leucine (CHEBI:133521) is a indoleacetic acid amide conjugate (CHEBI:64632) |
| N-(indole-3-acetyl)leucine (CHEBI:133521) is a leucine derivative (CHEBI:47003) |
| Incoming Relation(s) |
| N-(indole-3-acetyl)-L-leucine (CHEBI:71675) is a N-(indole-3-acetyl)leucine (CHEBI:133521) |
| IUPAC Name |
|---|
| N-[(1H-indol-3-yl)acetyl]leucine |
| Synonyms | Source |
|---|---|
| indole-3-acetyl-Leu | MetaCyc |
| IAA-Leu | MetaCyc |
| (indol-3-ylacetyl)leucine | ChEBI |
| (indole-3-acetyl)leucine | ChEBI |
| N-(indol-3-ylacetyl)leucine | ChEBI |
| indole-3-acetyl-leucine | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| INDOLE-3-ACETYL-LEU | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:35058 | Reaxys |