EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O5 |
| Net Charge | 0 |
| Average Mass | 304.302 |
| Monoisotopic Mass | 304.10592 |
| SMILES | O=C(O)CCC(NC(=O)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H16N2O5/c18-13(17-12(15(21)22)5-6-14(19)20)7-9-8-16-11-4-2-1-3-10(9)11/h1-4,8,12,16H,5-7H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | YRKLGWOHYXIKSF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indole-3-acetyl)glutamic acid (CHEBI:136547) has functional parent indole-3-acetic acid (CHEBI:16411) |
| N-(indole-3-acetyl)glutamic acid (CHEBI:136547) is a indoleacetic acid amide conjugate (CHEBI:64632) |
| N-(indole-3-acetyl)glutamic acid (CHEBI:136547) is a N-acylglutamic acid (CHEBI:21658) |
| N-(indole-3-acetyl)glutamic acid (CHEBI:136547) is conjugate acid of N-(indole-3-acetyl)glutamate(2−) (CHEBI:133516) |
| Incoming Relation(s) |
| N-(indole-3-acetyl)glutamate(2−) (CHEBI:133516) is conjugate base of N-(indole-3-acetyl)glutamic acid (CHEBI:136547) |
| Synonyms | Source |
|---|---|
| N-(indol-3-ylacetyl)glutamic acid | ChEBI |
| (indole-3-acetyl)glutamic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:443565 | Reaxys |