EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8NO2 |
| Net Charge | -1 |
| Average Mass | 174.179 |
| Monoisotopic Mass | 174.05605 |
| SMILES | O=C([O-])Cc1cnc2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 |
| InChIKey | SEOVTRFCIGRIMH-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-acetate (CHEBI:30854) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| indole-3-acetate (CHEBI:30854) has role human metabolite (CHEBI:77746) |
| indole-3-acetate (CHEBI:30854) has role plant metabolite (CHEBI:76924) |
| indole-3-acetate (CHEBI:30854) is a indol-3-yl carboxylic acid anion (CHEBI:38468) |
| indole-3-acetate (CHEBI:30854) is conjugate base of indole-3-acetic acid (CHEBI:16411) |
| Incoming Relation(s) |
| indole-3-acetic acid (CHEBI:16411) is conjugate acid of indole-3-acetate (CHEBI:30854) |
| IUPAC Name |
|---|
| 1H-indol-3-ylacetate |
| Synonym | Source |
|---|---|
| 2-(indol-3-yl)ethanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (indol-3-yl)acetate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329972 | Gmelin |
| Reaxys:3906817 | Reaxys |