EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2S |
| Net Charge | 0 |
| Average Mass | 120.153 |
| Monoisotopic Mass | 120.01192 |
| SMILES | N[C@H](C[S])C(=O)O |
| InChI | InChI=1S/C3H6NO2S/c4-2(1-7)3(5)6/h2H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | BQXFQDOHKMTBDK-UWTATZPHSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cysteinyl radical (CHEBI:32738) has functional parent D-cysteine (CHEBI:16375) |
| D-cysteinyl radical (CHEBI:32738) has role fundamental metabolite (CHEBI:78675) |
| D-cysteinyl radical (CHEBI:32738) is a D-amino acid radical (CHEBI:33546) |
| D-cysteinyl radical (CHEBI:32738) is a cysteinyl radical (CHEBI:32740) |
| D-cysteinyl radical (CHEBI:32738) is enantiomer of L-cysteinyl radical (CHEBI:32736) |
| Incoming Relation(s) |
| L-cysteinyl radical (CHEBI:32736) is enantiomer of D-cysteinyl radical (CHEBI:32738) |
| D-cysteinyl radical residue (CHEBI:32739) is substituent group from D-cysteinyl radical (CHEBI:32738) |
| IUPAC Name |
|---|
| [(2S)-2-amino-2-carboxyethyl]sulfanyl |
| Synonyms | Source |
|---|---|
| D-cysteine(•) | ChEBI |
| D-cystein-S-yl | ChEBI |
| D-cysteine radical | ChEBI |
| D-cysteine thiyl radical | ChEBI |