EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4S2 |
| Net Charge | 0 |
| Average Mass | 240.306 |
| Monoisotopic Mass | 240.02385 |
| SMILES | N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | LEVWYRKDKASIDU-IMJSIDKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | flour treatment agent A food additive which is added to flour or dough to improve baking quality and/or colour. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | flour treatment agent A food additive which is added to flour or dough to improve baking quality and/or colour. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor Any EC 1.2.1.* (oxidoreductase acting on donor aldehyde/oxo group with NAD+ or NADP+ as acceptor) inhibitor that inhibits the action of aspartate-semialdehyde dehydrogenase (EC 1.2.1.11). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | flour treatment agent A food additive which is added to flour or dough to improve baking quality and/or colour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cystine (CHEBI:16283) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-cystine (CHEBI:16283) has role EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor (CHEBI:145814) |
| L-cystine (CHEBI:16283) has role flour treatment agent (CHEBI:64577) |
| L-cystine (CHEBI:16283) has role human metabolite (CHEBI:77746) |
| L-cystine (CHEBI:16283) has role mouse metabolite (CHEBI:75771) |
| L-cystine (CHEBI:16283) is a L-cysteine derivative (CHEBI:83824) |
| L-cystine (CHEBI:16283) is a cystine (CHEBI:17376) |
| L-cystine (CHEBI:16283) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-cystine (CHEBI:16283) is conjugate acid of L-cystine anion (CHEBI:63163) |
| L-cystine (CHEBI:16283) is enantiomer of D-cystine (CHEBI:35494) |
| L-cystine (CHEBI:16283) is tautomer of L-cystine zwitterion (CHEBI:35491) |
| Incoming Relation(s) |
| L-cystine di-2-naphthylamide (CHEBI:90428) has functional parent L-cystine (CHEBI:16283) |
| L-cystine mono-2-naphthylamide (CHEBI:90427) has functional parent L-cystine (CHEBI:16283) |
| L-cystine anion (CHEBI:63163) is conjugate base of L-cystine (CHEBI:16283) |
| D-cystine (CHEBI:35494) is enantiomer of L-cystine (CHEBI:16283) |
| L-cystine residue (CHEBI:50058) is substituent group from L-cystine (CHEBI:16283) |
| L-cystinyl group (CHEBI:50066) is substituent group from L-cystine (CHEBI:16283) |
| L-cystyl group (CHEBI:50057) is substituent group from L-cystine (CHEBI:16283) |
| L-cystine zwitterion (CHEBI:35491) is tautomer of L-cystine (CHEBI:16283) |
| IUPAC Names |
|---|
| (2R,2'R)-3,3'-disulfanediylbis(2-aminopropanoic acid) |
| L-cystine |
| Synonyms | Source |
|---|---|
| 3,3'-Dithiobis-L-alanine | ChemIDplus |
| bis(β-amino-β-carboxyethyl) disulfide | NIST Chemistry WebBook |
| E921 | ChEBI |
| L-alpha-Diamino-beta-dithiolactic acid | KEGG COMPOUND |
| L-Cystine | KEGG COMPOUND |
| L-Dicysteine | KEGG COMPOUND |
| Citations |
|---|