EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O4S2 |
| Net Charge | -2 |
| Average Mass | 238.290 |
| Monoisotopic Mass | 238.00930 |
| SMILES | N[C@@H](CSSC[C@H](N)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/p-2/t3-,4-/m0/s1 |
| InChIKey | LEVWYRKDKASIDU-IMJSIDKUSA-L |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cystine anion (CHEBI:63163) has role human metabolite (CHEBI:77746) |
| L-cystine anion (CHEBI:63163) is a L-α-amino acid anion (CHEBI:59814) |
| L-cystine anion (CHEBI:63163) is conjugate base of L-cystine (CHEBI:16283) |
| Incoming Relation(s) |
| L-cystine (CHEBI:16283) is conjugate acid of L-cystine anion (CHEBI:63163) |
| IUPAC Name |
|---|
| (2R,2'R)-3,3'-disulfanediylbis(2-aminopropanoate) |
| Synonym | Source |
|---|---|
| L-cystine dianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6116766 | Reaxys |